C11H14N6O2 — CID 80873031
4-imidazol-1-yl-6-(oxolan-3-ylmethoxy)-1,3,5-triazin-2-amine (PubChem CID 80873031) has the molecular formula C11H14N6O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 4-imidazol-1-yl-6-(oxolan-3-ylmethoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-imidazol-1-yl-6-(oxolan-3-ylmethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80873031 |
| Molecular Formula | C11H14N6O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-imidazol-1-yl-6-(oxolan-3-ylmethoxy)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(OCC2CCOC2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C11H14N6O2/c12-9-14-10(17-3-2-13-7-17)16-11(15-9)19-6-8-1-4-18-5-8/h2-3,7-8H,1,4-6H2,(H2,12,14,15,16) |
| InChIKey | MQOWURWUIWLNSQ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |