C9H8F4N6O — CID 80867876
4-imidazol-1-yl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazin-2-amine (PubChem CID 80867876) has the molecular formula C9H8F4N6O and a molecular weight of 292.20 g/mol. Its IUPAC name is 4-imidazol-1-yl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-imidazol-1-yl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80867876 |
| Molecular Formula | C9H8F4N6O |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-imidazol-1-yl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(OCC(F)(F)C(F)F)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C9H8F4N6O/c10-5(11)9(12,13)3-20-8-17-6(14)16-7(18-8)19-2-1-15-4-19/h1-2,4-5H,3H2,(H2,14,16,17,18) |
| InChIKey | OWWVYGNHANTZBE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|