C14H14N6O — CID 80845966
4-(3-ethylphenoxy)-6-imidazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80845966) has the molecular formula C14H14N6O and a molecular weight of 282.31 g/mol. Its IUPAC name is 4-(3-ethylphenoxy)-6-imidazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-ethylphenoxy)-6-imidazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80845966 |
| Molecular Formula | C14H14N6O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-(3-ethylphenoxy)-6-imidazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCc1cccc(Oc2nc(N)nc(-n3ccnc3)n2)c1 |
| InChI | InChI=1S/C14H14N6O/c1-2-10-4-3-5-11(8-10)21-14-18-12(15)17-13(19-14)20-7-6-16-9-20/h3-9H,2H2,1H3,(H2,15,17,18,19) |
| InChIKey | USEZAOYLEOBHFX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |