C11H20N4O5 — CID 104568131
4-methoxy-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1,3,5-triazin-2-amine (PubChem CID 104568131) has the molecular formula C11H20N4O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-methoxy-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 104568131 |
| Molecular Formula | C11H20N4O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-methoxy-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1,3,5-triazin-2-amine |
| SMILES | COCCOCCOCCOc1nc(N)nc(OC)n1 |
| InChI | InChI=1S/C11H20N4O5/c1-16-3-4-18-5-6-19-7-8-20-11-14-9(12)13-10(15-11)17-2/h3-8H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | NUJJYFHREZMCNL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|