C7H7F5N4O2 — CID 80878300
4-methoxy-6-(2,2,3,3,3-pentafluoropropoxy)-1,3,5-triazin-2-amine (PubChem CID 80878300) has the molecular formula C7H7F5N4O2 and a molecular weight of 274.15 g/mol. Its IUPAC name is 4-methoxy-6-(2,2,3,3,3-pentafluoropropoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-6-(2,2,3,3,3-pentafluoropropoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80878300 |
| Molecular Formula | C7H7F5N4O2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4-methoxy-6-(2,2,3,3,3-pentafluoropropoxy)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N)nc(OCC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C7H7F5N4O2/c1-17-4-14-3(13)15-5(16-4)18-2-6(8,9)7(10,11)12/h2H2,1H3,(H2,13,14,15,16) |
| InChIKey | NGYJYNLHSFDTSQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|