C21H24N12O12 — CID 170244173
2,4,6-tris[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxymethoxy]-1,3,5-triazine (PubChem CID 170244173) has the molecular formula C21H24N12O12 and a molecular weight of 636.50 g/mol. Its IUPAC name is 2,4,6-tris[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxymethoxy]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxymethoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 170244173 |
| Molecular Formula | C21H24N12O12 |
| Molecular Weight | 636.50 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | 2,4,6-tris[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxymethoxy]-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(OCOc2nc(OCOc3nc(OC)nc(OC)n3)nc(OCOc3nc(OC)nc(OC)n3)n2)n1 |
| InChI | InChI=1S/C21H24N12O12/c1-34-10-22-11(35-2)26-16(25-10)40-7-43-19-31-20(44-8-41-17-27-12(36-3)23-13(28-17)37-4)33-21(32-19)45-9-42-18-29-14(38-5)24-15(30-18)39-6/h7-9H2,1-6H3 |
| InChIKey | YPALNXMKSFNNHW-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 265.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.50 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|