C9H14ClN3O3 — CID 62859308
2-chloro-4-methoxy-6-(2-propan-2-yloxyethoxy)-1,3,5-triazine (PubChem CID 62859308) has the molecular formula C9H14ClN3O3 and a molecular weight of 247.68 g/mol. Its IUPAC name is 2-chloro-4-methoxy-6-(2-propan-2-yloxyethoxy)-1,3,5-triazine.
| Compound Name | 2-chloro-4-methoxy-6-(2-propan-2-yloxyethoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 62859308 |
| Molecular Formula | C9H14ClN3O3 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 2-chloro-4-methoxy-6-(2-propan-2-yloxyethoxy)-1,3,5-triazine |
| SMILES | COc1nc(Cl)nc(OCCOC(C)C)n1 |
| InChI | InChI=1S/C9H14ClN3O3/c1-6(2)15-4-5-16-9-12-7(10)11-8(13-9)14-3/h6H,4-5H2,1-3H3 |
| InChIKey | ABWUNVLCVVNULO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|