C12H20ClN3O3 — CID 55124098
2-(2-butoxyethoxy)-4-chloro-6-propan-2-yloxy-1,3,5-triazine (PubChem CID 55124098) has the molecular formula C12H20ClN3O3 and a molecular weight of 289.76 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)-4-chloro-6-propan-2-yloxy-1,3,5-triazine.
| Compound Name | 2-(2-butoxyethoxy)-4-chloro-6-propan-2-yloxy-1,3,5-triazine |
|---|---|
| PubChem CID | 55124098 |
| Molecular Formula | C12H20ClN3O3 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-(2-butoxyethoxy)-4-chloro-6-propan-2-yloxy-1,3,5-triazine |
| SMILES | CCCCOCCOc1nc(Cl)nc(OC(C)C)n1 |
| InChI | InChI=1S/C12H20ClN3O3/c1-4-5-6-17-7-8-18-11-14-10(13)15-12(16-11)19-9(2)3/h9H,4-8H2,1-3H3 |
| InChIKey | ROVAHKFGFQLFJX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|