C15H28N4O2 — CID 80842496
4-hexoxy-6-propan-2-yloxy-N-propyl-1,3,5-triazin-2-amine (PubChem CID 80842496) has the molecular formula C15H28N4O2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 4-hexoxy-6-propan-2-yloxy-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-hexoxy-6-propan-2-yloxy-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80842496 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 4-hexoxy-6-propan-2-yloxy-N-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCCCCOc1nc(NCCC)nc(OC(C)C)n1 |
| InChI | InChI=1S/C15H28N4O2/c1-5-7-8-9-11-20-14-17-13(16-10-6-2)18-15(19-14)21-12(3)4/h12H,5-11H2,1-4H3,(H,16,17,18,19) |
| InChIKey | KKUVVJSHNSUTKG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|