C11H18ClN3OS — CID 107751046
2-chloro-4-pentylsulfanyl-6-propan-2-yloxy-1,3,5-triazine (PubChem CID 107751046) has the molecular formula C11H18ClN3OS and a molecular weight of 275.81 g/mol. Its IUPAC name is 2-chloro-4-pentylsulfanyl-6-propan-2-yloxy-1,3,5-triazine.
| Compound Name | 2-chloro-4-pentylsulfanyl-6-propan-2-yloxy-1,3,5-triazine |
|---|---|
| PubChem CID | 107751046 |
| Molecular Formula | C11H18ClN3OS |
| Molecular Weight | 275.81 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-chloro-4-pentylsulfanyl-6-propan-2-yloxy-1,3,5-triazine |
| SMILES | CCCCCSc1nc(Cl)nc(OC(C)C)n1 |
| InChI | InChI=1S/C11H18ClN3OS/c1-4-5-6-7-17-11-14-9(12)13-10(15-11)16-8(2)3/h8H,4-7H2,1-3H3 |
| InChIKey | LXARMNRFIYMEAY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|