C9H16N4OS — CID 107765408
4-methoxy-6-pentylsulfanyl-1,3,5-triazin-2-amine (PubChem CID 107765408) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-methoxy-6-pentylsulfanyl-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-6-pentylsulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 107765408 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-methoxy-6-pentylsulfanyl-1,3,5-triazin-2-amine |
| SMILES | CCCCCSc1nc(N)nc(OC)n1 |
| InChI | InChI=1S/C9H16N4OS/c1-3-4-5-6-15-9-12-7(10)11-8(13-9)14-2/h3-6H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | SZKNMHFZBYTWMS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|