C7H13N5OS — CID 80924545
(4-methoxy-6-propylsulfanyl-1,3,5-triazin-2-yl)hydrazine (PubChem CID 80924545) has the molecular formula C7H13N5OS and a molecular weight of 215.28 g/mol. Its IUPAC name is (4-methoxy-6-propylsulfanyl-1,3,5-triazin-2-yl)hydrazine.
| Compound Name | (4-methoxy-6-propylsulfanyl-1,3,5-triazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80924545 |
| Molecular Formula | C7H13N5OS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | (4-methoxy-6-propylsulfanyl-1,3,5-triazin-2-yl)hydrazine |
| SMILES | CCCSc1nc(NN)nc(OC)n1 |
| InChI | InChI=1S/C7H13N5OS/c1-3-4-14-7-10-5(12-8)9-6(11-7)13-2/h3-4,8H2,1-2H3,(H,9,10,11,12) |
| InChIKey | QPZQBHCWFATWBX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|