C6H9F2N5O2 — CID 82010197
[4-(2,2-difluoroethoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 82010197) has the molecular formula C6H9F2N5O2 and a molecular weight of 221.17 g/mol. Its IUPAC name is [4-(2,2-difluoroethoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(2,2-difluoroethoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 82010197 |
| Molecular Formula | C6H9F2N5O2 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | [4-(2,2-difluoroethoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | COc1nc(NN)nc(OCC(F)F)n1 |
| InChI | InChI=1S/C6H9F2N5O2/c1-14-5-10-4(13-9)11-6(12-5)15-2-3(7)8/h3H,2,9H2,1H3,(H,10,11,12,13) |
| InChIKey | BUQHZIJPKSUIQW-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|