C8H14F2N6O2 — CID 107495412
2-[2,2-difluoroethyl-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]ethanol (PubChem CID 107495412) has the molecular formula C8H14F2N6O2 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 107495412 |
| Molecular Formula | C8H14F2N6O2 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-[2,2-difluoroethyl-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]ethanol |
| SMILES | COc1nc(NN)nc(N(CCO)CC(F)F)n1 |
| InChI | InChI=1S/C8H14F2N6O2/c1-18-8-13-6(15-11)12-7(14-8)16(2-3-17)4-5(9)10/h5,17H,2-4,11H2,1H3,(H,12,13,14,15) |
| InChIKey | ZIKAOKNLIXVWQN-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|