C10H19N7O2 — CID 80904852
2-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-propylamino]-N-methylacetamide (PubChem CID 80904852) has the molecular formula C10H19N7O2 and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-propylamino]-N-methylacetamide.
| Compound Name | 2-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-propylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 80904852 |
| Molecular Formula | C10H19N7O2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-propylamino]-N-methylacetamide |
| SMILES | CCCN(CC(=O)NC)c1nc(NN)nc(OC)n1 |
| InChI | InChI=1S/C10H19N7O2/c1-4-5-17(6-7(18)12-2)9-13-8(16-11)14-10(15-9)19-3/h4-6,11H2,1-3H3,(H,12,18)(H,13,14,15,16) |
| InChIKey | XSVDSOIQTAEILA-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|