C9H16N8O3 — CID 80919652
2-[(2-amino-2-oxoethyl)-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)amino]acetamide (PubChem CID 80919652) has the molecular formula C9H16N8O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)amino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 80919652 |
| Molecular Formula | C9H16N8O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)amino]acetamide |
| SMILES | CCOc1nc(NN)nc(N(CC(N)=O)CC(N)=O)n1 |
| InChI | InChI=1S/C9H16N8O3/c1-2-20-9-14-7(16-12)13-8(15-9)17(3-5(10)18)4-6(11)19/h2-4,12H2,1H3,(H2,10,18)(H2,11,19)(H,13,14,15,16) |
| InChIKey | ACIJGEDXMFPAOD-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|