C9H15F3N6O — CID 80910058
N,N-diethyl-4-hydrazinyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine (PubChem CID 80910058) has the molecular formula C9H15F3N6O and a molecular weight of 280.25 g/mol. Its IUPAC name is N,N-diethyl-4-hydrazinyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine.
| Compound Name | N,N-diethyl-4-hydrazinyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80910058 |
| Molecular Formula | C9H15F3N6O |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N,N-diethyl-4-hydrazinyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(NN)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H15F3N6O/c1-3-18(4-2)7-14-6(17-13)15-8(16-7)19-5-9(10,11)12/h3-5,13H2,1-2H3,(H,14,15,16,17) |
| InChIKey | PUQQASHAASDKNE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|