C13H27N7 — CID 106332376
4-N,4-N-diethyl-6-hydrazinyl-2-N-(3-methylpentan-3-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 106332376) has the molecular formula C13H27N7 and a molecular weight of 281.41 g/mol. Its IUPAC name is 4-N,4-N-diethyl-6-hydrazinyl-2-N-(3-methylpentan-3-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N,4-N-diethyl-6-hydrazinyl-2-N-(3-methylpentan-3-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106332376 |
| Molecular Formula | C13H27N7 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.23 |
| IUPAC Name | 4-N,4-N-diethyl-6-hydrazinyl-2-N-(3-methylpentan-3-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(NN)nc(NC(C)(CC)CC)n1 |
| InChI | InChI=1S/C13H27N7/c1-6-13(5,7-2)18-10-15-11(19-14)17-12(16-10)20(8-3)9-4/h6-9,14H2,1-5H3,(H2,15,16,17,18,19) |
| InChIKey | XBRIVPFTGSOABT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|