C11H23N7S — CID 113467023
4-N,4-N-diethyl-6-hydrazinyl-2-N-(2-methylsulfanylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 113467023) has the molecular formula C11H23N7S and a molecular weight of 285.42 g/mol. Its IUPAC name is 4-N,4-N-diethyl-6-hydrazinyl-2-N-(2-methylsulfanylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N,4-N-diethyl-6-hydrazinyl-2-N-(2-methylsulfanylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 113467023 |
| Molecular Formula | C11H23N7S |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 4-N,4-N-diethyl-6-hydrazinyl-2-N-(2-methylsulfanylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(NN)nc(NCC(C)SC)n1 |
| InChI | InChI=1S/C11H23N7S/c1-5-18(6-2)11-15-9(13-7-8(3)19-4)14-10(16-11)17-12/h8H,5-7,12H2,1-4H3,(H2,13,14,15,16,17) |
| InChIKey | GEJRRHRQYGQVJA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|