C9H20N8O2S — CID 80906358
2-[[4-(diethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]ethanesulfonamide (PubChem CID 80906358) has the molecular formula C9H20N8O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-[[4-(diethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]ethanesulfonamide.
| Compound Name | 2-[[4-(diethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]ethanesulfonamide |
|---|---|
| PubChem CID | 80906358 |
| Molecular Formula | C9H20N8O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[[4-(diethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]ethanesulfonamide |
| SMILES | CCN(CC)c1nc(NN)nc(NCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C9H20N8O2S/c1-3-17(4-2)9-14-7(13-8(15-9)16-10)12-5-6-20(11,18)19/h3-6,10H2,1-2H3,(H2,11,18,19)(H2,12,13,14,15,16) |
| InChIKey | QDKDFOQNOKICES-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 152.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|