C10H20N6 — CID 80765267
2-N,2-N-diethyl-4-N-propyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80765267) has the molecular formula C10H20N6 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-N,2-N-diethyl-4-N-propyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-diethyl-4-N-propyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80765267 |
| Molecular Formula | C10H20N6 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 2-N,2-N-diethyl-4-N-propyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCNc1nc(N)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C10H20N6/c1-4-7-12-9-13-8(11)14-10(15-9)16(5-2)6-3/h4-7H2,1-3H3,(H3,11,12,13,14,15) |
| InChIKey | VLFJOEWVDDQVKQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |