C11H21N7O — CID 80788576
N-[2-[[4-amino-6-(diethylamino)-1,3,5-triazin-2-yl]amino]ethyl]acetamide (PubChem CID 80788576) has the molecular formula C11H21N7O and a molecular weight of 267.34 g/mol. Its IUPAC name is N-[2-[[4-amino-6-(diethylamino)-1,3,5-triazin-2-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[4-amino-6-(diethylamino)-1,3,5-triazin-2-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 80788576 |
| Molecular Formula | C11H21N7O |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-[2-[[4-amino-6-(diethylamino)-1,3,5-triazin-2-yl]amino]ethyl]acetamide |
| SMILES | CCN(CC)c1nc(N)nc(NCCNC(C)=O)n1 |
| InChI | InChI=1S/C11H21N7O/c1-4-18(5-2)11-16-9(12)15-10(17-11)14-7-6-13-8(3)19/h4-7H2,1-3H3,(H,13,19)(H3,12,14,15,16,17) |
| InChIKey | VCPKRZFUUWNELD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|