C10H17F3N6S — CID 106433977
2-N,2-N-diethyl-4-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 106433977) has the molecular formula C10H17F3N6S and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-N,2-N-diethyl-4-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-diethyl-4-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 106433977 |
| Molecular Formula | C10H17F3N6S |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-N,2-N-diethyl-4-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(N)nc(NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C10H17F3N6S/c1-3-19(4-2)9-17-7(14)16-8(18-9)15-5-6-20-10(11,12)13/h3-6H2,1-2H3,(H3,14,15,16,17,18) |
| InChIKey | BWYYZRAXPMOQFG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|