C7H16N8 — CID 134416295
N-tert-butyl-4,6-dihydrazinyl-1,3,5-triazin-2-amine (PubChem CID 134416295) has the molecular formula C7H16N8 and a molecular weight of 212.26 g/mol. Its IUPAC name is N-tert-butyl-4,6-dihydrazinyl-1,3,5-triazin-2-amine.
| Compound Name | N-tert-butyl-4,6-dihydrazinyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 134416295 |
| Molecular Formula | C7H16N8 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N-tert-butyl-4,6-dihydrazinyl-1,3,5-triazin-2-amine |
| SMILES | CC(C)(C)Nc1nc(NN)nc(NN)n1 |
| InChI | InChI=1S/C7H16N8/c1-7(2,3)13-4-10-5(14-8)12-6(11-4)15-9/h8-9H2,1-3H3,(H3,10,11,12,13,14,15) |
| InChIKey | FLHKDZQXVBCEAS-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|