C10H14F2N2O2 — CID 107484208
2-[2,2-difluoroethyl-(6-methoxy-2-pyridinyl)amino]ethanol (PubChem CID 107484208) has the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-(6-methoxy-2-pyridinyl)amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl-(6-methoxy-2-pyridinyl)amino]ethanol |
|---|---|
| PubChem CID | 107484208 |
| Molecular Formula | C10H14F2N2O2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-[2,2-difluoroethyl-(6-methoxy-2-pyridinyl)amino]ethanol |
| SMILES | COc1cccc(N(CCO)CC(F)F)n1 |
| InChI | InChI=1S/C10H14F2N2O2/c1-16-10-4-2-3-9(13-10)14(5-6-15)7-8(11)12/h2-4,8,15H,5-7H2,1H3 |
| InChIKey | LKEJXCMBPBJDPT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |