C10H14F2N4O2 — CID 136858019
6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 136858019) has the molecular formula C10H14F2N4O2 and a molecular weight of 260.24 g/mol. Its IUPAC name is 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136858019 |
| Molecular Formula | C10H14F2N4O2 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1cccc(N(CCO)CC(F)F)n1 |
| InChI | InChI=1S/C10H14F2N4O2/c11-8(12)6-16(4-5-17)9-3-1-2-7(14-9)10(13)15-18/h1-3,8,17-18H,4-6H2,(H2,13,15) |
| InChIKey | YZJXXKKBKWMHBE-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|