C10H16N4O2 — CID 136990515
5-[ethyl(2-hydroxyethyl)amino]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 136990515) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 5-[ethyl(2-hydroxyethyl)amino]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 5-[ethyl(2-hydroxyethyl)amino]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136990515 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 5-[ethyl(2-hydroxyethyl)amino]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | CCN(CCO)c1ccc(/C(N)=N/O)nc1 |
| InChI | InChI=1S/C10H16N4O2/c1-2-14(5-6-15)8-3-4-9(12-7-8)10(11)13-16/h3-4,7,15-16H,2,5-6H2,1H3,(H2,11,13) |
| InChIKey | YAMBJGVCAOOFAX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|