C13H19F2N3O2S — CID 107480056
2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-ethylsulfanyl-N'-hydroxybenzenecarboximidamide (PubChem CID 107480056) has the molecular formula C13H19F2N3O2S and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-ethylsulfanyl-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-ethylsulfanyl-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107480056 |
| Molecular Formula | C13H19F2N3O2S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-ethylsulfanyl-N'-hydroxybenzenecarboximidamide |
| SMILES | CCSc1cccc(N(CCO)CC(F)F)c1/C(N)=N/O |
| InChI | InChI=1S/C13H19F2N3O2S/c1-2-21-10-5-3-4-9(12(10)13(16)17-20)18(6-7-19)8-11(14)15/h3-5,11,19-20H,2,6-8H2,1H3,(H2,16,17) |
| InChIKey | SLVMJRRRDTXLIK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|