C14H22N2OS2 — CID 107749725
2-ethylsulfanyl-N'-hydroxy-6-(2-methylbutylsulfanyl)benzenecarboximidamide (PubChem CID 107749725) has the molecular formula C14H22N2OS2 and a molecular weight of 298.48 g/mol. Its IUPAC name is 2-ethylsulfanyl-N'-hydroxy-6-(2-methylbutylsulfanyl)benzenecarboximidamide.
| Compound Name | 2-ethylsulfanyl-N'-hydroxy-6-(2-methylbutylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 107749725 |
| Molecular Formula | C14H22N2OS2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-ethylsulfanyl-N'-hydroxy-6-(2-methylbutylsulfanyl)benzenecarboximidamide |
| SMILES | CCSc1cccc(SCC(C)CC)c1/C(N)=N/O |
| InChI | InChI=1S/C14H22N2OS2/c1-4-10(3)9-19-12-8-6-7-11(18-5-2)13(12)14(15)16-17/h6-8,10,17H,4-5,9H2,1-3H3,(H2,15,16) |
| InChIKey | GMPLUXHEOUBNPE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|