C13H20N2S2 — CID 113385931
2-ethylsulfanyl-6-(2-methylpropylsulfanyl)benzenecarboximidamide (PubChem CID 113385931) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-(2-methylpropylsulfanyl)benzenecarboximidamide.
| Compound Name | 2-ethylsulfanyl-6-(2-methylpropylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 113385931 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-ethylsulfanyl-6-(2-methylpropylsulfanyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(SCC)cccc1SCC(C)C |
| InChI | InChI=1S/C13H20N2S2/c1-4-16-10-6-5-7-11(12(10)13(14)15)17-8-9(2)3/h5-7,9H,4,8H2,1-3H3,(H3,14,15) |
| InChIKey | XFUYECVCTYDOIS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|