C13H21N3S — CID 113385854
2-(tert-butylamino)-6-ethylsulfanylbenzenecarboximidamide (PubChem CID 113385854) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 2-(tert-butylamino)-6-ethylsulfanylbenzenecarboximidamide.
| Compound Name | 2-(tert-butylamino)-6-ethylsulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 113385854 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-(tert-butylamino)-6-ethylsulfanylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(NC(C)(C)C)cccc1SCC |
| InChI | InChI=1S/C13H21N3S/c1-5-17-10-8-6-7-9(11(10)12(14)15)16-13(2,3)4/h6-8,16H,5H2,1-4H3,(H3,14,15) |
| InChIKey | DFKFPHNJGYCSNA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|