C10H13FN2OS — CID 79522692
2-fluoro-N'-hydroxy-6-propan-2-ylsulfanylbenzenecarboximidamide (PubChem CID 79522692) has the molecular formula C10H13FN2OS and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-6-propan-2-ylsulfanylbenzenecarboximidamide.
| Compound Name | 2-fluoro-N'-hydroxy-6-propan-2-ylsulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 79522692 |
| Molecular Formula | C10H13FN2OS |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-fluoro-N'-hydroxy-6-propan-2-ylsulfanylbenzenecarboximidamide |
| SMILES | CC(C)Sc1cccc(F)c1C(N)=NO |
| InChI | InChI=1S/C10H13FN2OS/c1-6(2)15-8-5-3-4-7(11)9(8)10(12)13-14/h3-6,14H,1-2H3,(H2,12,13) |
| InChIKey | VAODDEQSJGRKSD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|