C14H15FN4OS — CID 79516971
2-fluoro-N'-hydroxy-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzenecarboximidamide (PubChem CID 79516971) has the molecular formula C14H15FN4OS and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzenecarboximidamide.
| Compound Name | 2-fluoro-N'-hydroxy-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 79516971 |
| Molecular Formula | C14H15FN4OS |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-fluoro-N'-hydroxy-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzenecarboximidamide |
| SMILES | Cc1nc(Sc2cccc(F)c2C(N)=NO)nc(C)c1C |
| InChI | InChI=1S/C14H15FN4OS/c1-7-8(2)17-14(18-9(7)3)21-11-6-4-5-10(15)12(11)13(16)19-20/h4-6,20H,1-3H3,(H2,16,19) |
| InChIKey | VYPVSBVRUKEHRZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|