C12H18F2N2O — CID 107480549
2-[2-[(1R)-1-aminoethyl]-N-(2,2-difluoroethyl)anilino]ethanol (PubChem CID 107480549) has the molecular formula C12H18F2N2O and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-[2-[(1R)-1-aminoethyl]-N-(2,2-difluoroethyl)anilino]ethanol.
| Compound Name | 2-[2-[(1R)-1-aminoethyl]-N-(2,2-difluoroethyl)anilino]ethanol |
|---|---|
| PubChem CID | 107480549 |
| Molecular Formula | C12H18F2N2O |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 2-[2-[(1R)-1-aminoethyl]-N-(2,2-difluoroethyl)anilino]ethanol |
| SMILES | C[C@@H](N)c1ccccc1N(CCO)CC(F)F |
| InChI | InChI=1S/C12H18F2N2O/c1-9(15)10-4-2-3-5-11(10)16(6-7-17)8-12(13)14/h2-5,9,12,17H,6-8,15H2,1H3/t9-/m1/s1 |
| InChIKey | CEZJKLSVUWEWMI-SECBINFHSA-N |
| XLogP | 1.77 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |