C12H17ClF2N2O — CID 107480561
2-[4-(1-aminoethyl)-2-chloro-N-(2,2-difluoroethyl)anilino]ethanol (PubChem CID 107480561) has the molecular formula C12H17ClF2N2O and a molecular weight of 278.73 g/mol. Its IUPAC name is 2-[4-(1-aminoethyl)-2-chloro-N-(2,2-difluoroethyl)anilino]ethanol.
| Compound Name | 2-[4-(1-aminoethyl)-2-chloro-N-(2,2-difluoroethyl)anilino]ethanol |
|---|---|
| PubChem CID | 107480561 |
| Molecular Formula | C12H17ClF2N2O |
| Molecular Weight | 278.73 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-[4-(1-aminoethyl)-2-chloro-N-(2,2-difluoroethyl)anilino]ethanol |
| SMILES | CC(N)c1ccc(N(CCO)CC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H17ClF2N2O/c1-8(16)9-2-3-11(10(13)6-9)17(4-5-18)7-12(14)15/h2-3,6,8,12,18H,4-5,7,16H2,1H3 |
| InChIKey | TUXDSUOCYYHSSL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |