C9H14F2N4O3 — CID 103081594
N-[2-(2,2-difluoroethoxy)ethyl]-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 103081594) has the molecular formula C9H14F2N4O3 and a molecular weight of 264.23 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 103081594 |
| Molecular Formula | C9H14F2N4O3 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NCCOCC(F)F)nc(OC)n1 |
| InChI | InChI=1S/C9H14F2N4O3/c1-16-8-13-7(14-9(15-8)17-2)12-3-4-18-5-6(10)11/h6H,3-5H2,1-2H3,(H,12,13,14,15) |
| InChIKey | TZMCTGYNIMCCPT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|