C11H18F2N4O — CID 114129076
4-N-[2-(2,2-difluoroethoxy)ethyl]-6-N,2,5-trimethylpyrimidine-4,6-diamine (PubChem CID 114129076) has the molecular formula C11H18F2N4O and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-N-[2-(2,2-difluoroethoxy)ethyl]-6-N,2,5-trimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(2,2-difluoroethoxy)ethyl]-6-N,2,5-trimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 114129076 |
| Molecular Formula | C11H18F2N4O |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-N-[2-(2,2-difluoroethoxy)ethyl]-6-N,2,5-trimethylpyrimidine-4,6-diamine |
| SMILES | CNc1nc(C)nc(NCCOCC(F)F)c1C |
| InChI | InChI=1S/C11H18F2N4O/c1-7-10(14-3)16-8(2)17-11(7)15-4-5-18-6-9(12)13/h9H,4-6H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | IOAHHWUWYYKLAZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|