C7H11F2N3OS — CID 103081419
N-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 103081419) has the molecular formula C7H11F2N3OS and a molecular weight of 223.25 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 103081419 |
| Molecular Formula | C7H11F2N3OS |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1nsc(NCCOCC(F)F)n1 |
| InChI | InChI=1S/C7H11F2N3OS/c1-5-11-7(14-12-5)10-2-3-13-4-6(8)9/h6H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | SQKXUQHRJXJBFE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|