C7H13N3O2S — CID 107390179
N-(2,2-dimethoxyethyl)-3-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 107390179) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-methyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-3-methyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 107390179 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | COC(CNc1nc(C)ns1)OC |
| InChI | InChI=1S/C7H13N3O2S/c1-5-9-7(13-10-5)8-4-6(11-2)12-3/h6H,4H2,1-3H3,(H,8,9,10) |
| InChIKey | DXDYRSVDUKSRHR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|