About N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine
N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine (PubChem CID 65267731) has the molecular formula C5H10N4S
and a molecular weight of 158.23 g/mol. Its IUPAC name is N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine.
Analyze N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine?
The IUPAC name of N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine (CID 65267731) is N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine is Cc1nsc(NCCN)n1.
What is the InChIKey of N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine?
The InChIKey is YQILVHOEZPLKFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4S/c1-4-8-5(10-9-4)7-3-2-6/h2-3,6H2,1H3,(H,7,8,9).
What are the key properties of N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine?
N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine has a molecular weight of 158.23 g/mol, XLogP of 0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-methyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine is sourced from PubChem (CID 65267731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).