C9H14F2N2OS — CID 103081678
N-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,3-thiazol-2-amine (PubChem CID 103081678) has the molecular formula C9H14F2N2OS and a molecular weight of 236.29 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,3-thiazol-2-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 103081678 |
| Molecular Formula | C9H14F2N2OS |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,3-thiazol-2-amine |
| SMILES | CCc1csc(NCCOCC(F)F)n1 |
| InChI | InChI=1S/C9H14F2N2OS/c1-2-7-6-15-9(13-7)12-3-4-14-5-8(10)11/h6,8H,2-5H2,1H3,(H,12,13) |
| InChIKey | IKPNIELKFWVEQK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|