C9H17N3O2S2 — CID 106338122
N-ethyl-2-[(4-ethyl-1,3-thiazol-2-yl)amino]ethanesulfonamide (PubChem CID 106338122) has the molecular formula C9H17N3O2S2 and a molecular weight of 263.39 g/mol. Its IUPAC name is N-ethyl-2-[(4-ethyl-1,3-thiazol-2-yl)amino]ethanesulfonamide.
| Compound Name | N-ethyl-2-[(4-ethyl-1,3-thiazol-2-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 106338122 |
| Molecular Formula | C9H17N3O2S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N-ethyl-2-[(4-ethyl-1,3-thiazol-2-yl)amino]ethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNc1nc(CC)cs1 |
| InChI | InChI=1S/C9H17N3O2S2/c1-3-8-7-15-9(12-8)10-5-6-16(13,14)11-4-2/h7,11H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | HTGAEYPMOXFUNE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |