C11H16N4S — CID 115681727
4-ethyl-N-(3-pyrazol-1-ylpropyl)-1,3-thiazol-2-amine (PubChem CID 115681727) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is 4-ethyl-N-(3-pyrazol-1-ylpropyl)-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-(3-pyrazol-1-ylpropyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115681727 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 4-ethyl-N-(3-pyrazol-1-ylpropyl)-1,3-thiazol-2-amine |
| SMILES | CCc1csc(NCCCn2cccn2)n1 |
| InChI | InChI=1S/C11H16N4S/c1-2-10-9-16-11(14-10)12-5-3-7-15-8-4-6-13-15/h4,6,8-9H,2-3,5,7H2,1H3,(H,12,14) |
| InChIKey | AXQUACYSSLOMRN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|