C11H14N4O2S — CID 103487121
3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103487121) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103487121 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1csc(NCCn2cccn2)n1 |
| InChI | InChI=1S/C11H14N4O2S/c16-10(17)3-2-9-8-18-11(14-9)12-5-7-15-6-1-4-13-15/h1,4,6,8H,2-3,5,7H2,(H,12,14)(H,16,17) |
| InChIKey | WQSJSJVIIRFFJN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |