3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid

C11H14N4O2S — CID 103487121

IUPAC3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid
SMILESO=C(O)CCc1csc(NCCn2cccn2)n1
InChIInChI=1S/C11H14N4O2S/c16-10(17)3-2-9-8-18-11(14-9)12-5-7-15-6-1-4-13-15/h1,4,6,8H,2-3,5,7H2,(H,12,14)(H,16,17)
InChIKeyWQSJSJVIIRFFJN-UHFFFAOYSA-N
MW266.33 g/mol
LogP1.47
Rot. Bonds7

About 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid

3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103487121) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid
PubChem CID103487121
Molecular FormulaC11H14N4O2S
Molecular Weight266.33 g/mol
Exact Mass266.08
IUPAC Name3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid
SMILESO=C(O)CCc1csc(NCCn2cccn2)n1
InChIInChI=1S/C11H14N4O2S/c16-10(17)3-2-9-8-18-11(14-9)12-5-7-15-6-1-4-13-15/h1,4,6,8H,2-3,5,7H2,(H,12,14)(H,16,17)
InChIKeyWQSJSJVIIRFFJN-UHFFFAOYSA-N
XLogP1.47
TPSA80.04 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.33
LogP ≤ 51.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid?
The IUPAC name of 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid (CID 103487121) is 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid?
The canonical SMILES for 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid is O=C(O)CCc1csc(NCCn2cccn2)n1.
What is the InChIKey of 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid?
The InChIKey is WQSJSJVIIRFFJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2S/c16-10(17)3-2-9-8-18-11(14-9)12-5-7-15-6-1-4-13-15/h1,4,6,8H,2-3,5,7H2,(H,12,14)(H,16,17).
What are the key properties of 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid?
3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid has a molecular weight of 266.33 g/mol, XLogP of 1.47, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-pyrazol-1-ylethylamino)-1,3-thiazol-4-yl]propanoic acid is sourced from PubChem (CID 103487121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).