C16H16N4OS — CID 75477161
N-(4-benzyl-1,3-thiazol-2-yl)-3-pyrazol-1-ylpropanamide (PubChem CID 75477161) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is N-(4-benzyl-1,3-thiazol-2-yl)-3-pyrazol-1-ylpropanamide.
| Compound Name | N-(4-benzyl-1,3-thiazol-2-yl)-3-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 75477161 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-(4-benzyl-1,3-thiazol-2-yl)-3-pyrazol-1-ylpropanamide |
| SMILES | O=C(CCn1cccn1)Nc1nc(Cc2ccccc2)cs1 |
| InChI | InChI=1S/C16H16N4OS/c21-15(7-10-20-9-4-8-17-20)19-16-18-14(12-22-16)11-13-5-2-1-3-6-13/h1-6,8-9,12H,7,10-11H2,(H,18,19,21) |
| InChIKey | VGUHCBCKYBCKHW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |