C12H13N3O3S — CID 47268516
N-(benzenesulfonyl)-3-pyrazol-1-ylpropanamide (PubChem CID 47268516) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is N-(benzenesulfonyl)-3-pyrazol-1-ylpropanamide.
| Compound Name | N-(benzenesulfonyl)-3-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 47268516 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N-(benzenesulfonyl)-3-pyrazol-1-ylpropanamide |
| SMILES | O=C(CCn1cccn1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13N3O3S/c16-12(7-10-15-9-4-8-13-15)14-19(17,18)11-5-2-1-3-6-11/h1-6,8-9H,7,10H2,(H,14,16) |
| InChIKey | JMNUNIFZGFFIEG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |