C13H16N4O3S — CID 110747701
1-(4-methylphenyl)sulfonyl-3-(2-pyrazol-1-ylethyl)urea (PubChem CID 110747701) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-(2-pyrazol-1-ylethyl)urea.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-(2-pyrazol-1-ylethyl)urea |
|---|---|
| PubChem CID | 110747701 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-(2-pyrazol-1-ylethyl)urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NCCn2cccn2)cc1 |
| InChI | InChI=1S/C13H16N4O3S/c1-11-3-5-12(6-4-11)21(19,20)16-13(18)14-8-10-17-9-2-7-15-17/h2-7,9H,8,10H2,1H3,(H2,14,16,18) |
| InChIKey | JTEKFSPLELPMLK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |