C12H14BrN5O — CID 99623557
1-(5-bromo-6-methyl-2-pyridinyl)-3-(2-pyrazol-1-ylethyl)urea (PubChem CID 99623557) has the molecular formula C12H14BrN5O and a molecular weight of 324.18 g/mol. Its IUPAC name is 1-(5-bromo-6-methyl-2-pyridinyl)-3-(2-pyrazol-1-ylethyl)urea.
| Compound Name | 1-(5-bromo-6-methyl-2-pyridinyl)-3-(2-pyrazol-1-ylethyl)urea |
|---|---|
| PubChem CID | 99623557 |
| Molecular Formula | C12H14BrN5O |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-(5-bromo-6-methyl-2-pyridinyl)-3-(2-pyrazol-1-ylethyl)urea |
| SMILES | Cc1nc(NC(=O)NCCn2cccn2)ccc1Br |
| InChI | InChI=1S/C12H14BrN5O/c1-9-10(13)3-4-11(16-9)17-12(19)14-6-8-18-7-2-5-15-18/h2-5,7H,6,8H2,1H3,(H2,14,16,17,19) |
| InChIKey | QWHDMIOXSQMZDW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |