C10H17N3O4S2 — CID 106331954
3-[2-[3-(methanesulfonamido)propylamino]-1,3-thiazol-4-yl]propanoic acid (PubChem CID 106331954) has the molecular formula C10H17N3O4S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 3-[2-[3-(methanesulfonamido)propylamino]-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-[3-(methanesulfonamido)propylamino]-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 106331954 |
| Molecular Formula | C10H17N3O4S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-[2-[3-(methanesulfonamido)propylamino]-1,3-thiazol-4-yl]propanoic acid |
| SMILES | CS(=O)(=O)NCCCNc1nc(CCC(=O)O)cs1 |
| InChI | InChI=1S/C10H17N3O4S2/c1-19(16,17)12-6-2-5-11-10-13-8(7-18-10)3-4-9(14)15/h7,12H,2-6H2,1H3,(H,11,13)(H,14,15) |
| InChIKey | GCAUBJLOHKJVPM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|