C15H25N3O2S — CID 103485952
3-[2-[3-(2-methylpiperidin-1-yl)propylamino]-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103485952) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 3-[2-[3-(2-methylpiperidin-1-yl)propylamino]-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-[3-(2-methylpiperidin-1-yl)propylamino]-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103485952 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 3-[2-[3-(2-methylpiperidin-1-yl)propylamino]-1,3-thiazol-4-yl]propanoic acid |
| SMILES | CC1CCCCN1CCCNc1nc(CCC(=O)O)cs1 |
| InChI | InChI=1S/C15H25N3O2S/c1-12-5-2-3-9-18(12)10-4-8-16-15-17-13(11-21-15)6-7-14(19)20/h11-12H,2-10H2,1H3,(H,16,17)(H,19,20) |
| InChIKey | GNSQRUILNDPVST-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|